C43H40F2IrN2OSi-2 — CID 164712927
[4-(2-deuteriopropan-2-yl)-6-phenyl-3-pyridinyl]-trimethylsilane;5-fluoro-2-(7-fluoro-3H-dibenzofuran-3-id-4-yl)-4-(2,4,6-trimethylphenyl)pyridine;iridium (PubChem CID 164712927) has the molecular formula C43H40F2IrN2OSi-2 and a molecular weight of 860.11 g/mol. Its IUPAC name is [4-(2-deuteriopropan-2-yl)-6-phenyl-3-pyridinyl]-trimethylsilane;5-fluoro-2-(7-fluoro-3H-dibenzofuran-3-id-4-yl)-4-(2,4,6-trimethylphenyl)pyridine;iridium.
| Compound Name | [4-(2-deuteriopropan-2-yl)-6-phenyl-3-pyridinyl]-trimethylsilane;5-fluoro-2-(7-fluoro-3H-dibenzofuran-3-id-4-yl)-4-(2,4,6-trimethylphenyl)pyridine;iridium |
|---|---|
| PubChem CID | 164712927 |
| Molecular Formula | C43H40F2IrN2OSi-2 |
| Molecular Weight | 860.11 g/mol |
| Exact Mass | 860.26 |
| IUPAC Name | [4-(2-deuteriopropan-2-yl)-6-phenyl-3-pyridinyl]-trimethylsilane;5-fluoro-2-(7-fluoro-3H-dibenzofuran-3-id-4-yl)-4-(2,4,6-trimethylphenyl)pyridine;iridium |
| SMILES | Cc1cc(C)c(-c2cc(-c3[c-]ccc4c3oc3cc(F)ccc34)ncc2F)c(C)c1.[2H]C(C)(C)c1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.[Ir] |
| InChI | InChI=1S/C26H18F2NO.C17H22NSi.Ir/c1-14-9-15(2)25(16(3)10-14)21-12-23(29-13-22(21)28)20-6-4-5-19-18-8-7-17(27)11-24(18)30-26(19)20;1-13(2)15-11-16(14-9-7-6-8-10-14)18-12-17(15)19(3,4)5;/h4-5,7-13H,1-3H3;6-9,11-13H,1-5H3;/q2*-1;/i;13D; |
| InChIKey | IJMRFXWTHWOVBW-LTBAMTPYSA-N |
| XLogP | 11.53 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.11 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|