C46H46IrN2OSi-2 — CID 166576326
4-(1-deuteriocyclohexyl)-2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;[4-(2-deuteriopropan-2-yl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium (PubChem CID 166576326) has the molecular formula C46H46IrN2OSi-2 and a molecular weight of 865.20 g/mol. Its IUPAC name is 4-(1-deuteriocyclohexyl)-2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;[4-(2-deuteriopropan-2-yl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium.
| Compound Name | 4-(1-deuteriocyclohexyl)-2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;[4-(2-deuteriopropan-2-yl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
|---|---|
| PubChem CID | 166576326 |
| Molecular Formula | C46H46IrN2OSi-2 |
| Molecular Weight | 865.20 g/mol |
| Exact Mass | 865.31 |
| IUPAC Name | 4-(1-deuteriocyclohexyl)-2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;[4-(2-deuteriopropan-2-yl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
| SMILES | [2H]C(C)(C)c1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.[2H]C1(c2ccnc(-c3[c-]ccc4c3oc3cc(-c5ccccc5)ccc34)c2)CCCCC1.[Ir] |
| InChI | InChI=1S/C29H24NO.C17H22NSi.Ir/c1-3-8-20(9-4-1)22-14-15-24-25-12-7-13-26(29(25)31-28(24)19-22)27-18-23(16-17-30-27)21-10-5-2-6-11-21;1-13(2)15-11-16(14-9-7-6-8-10-14)18-12-17(15)19(3,4)5;/h1,3-4,7-9,12,14-19,21H,2,5-6,10-11H2;6-9,11-13H,1-5H3;/q2*-1;/i21D;13D; |
| InChIKey | RXYRIBMXEZPQGH-FDBICVGMSA-N |
| XLogP | 12.38 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.20 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|