C56H66IrN2OSi-2 — CID 166573947
4-cyclohexyl-2-[7-(3,5-ditert-butylphenyl)-3H-dibenzofuran-3-id-4-yl]pyridine;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium (PubChem CID 166573947) has the molecular formula C56H66IrN2OSi-2 and a molecular weight of 1003.46 g/mol. Its IUPAC name is 4-cyclohexyl-2-[7-(3,5-ditert-butylphenyl)-3H-dibenzofuran-3-id-4-yl]pyridine;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium.
| Compound Name | 4-cyclohexyl-2-[7-(3,5-ditert-butylphenyl)-3H-dibenzofuran-3-id-4-yl]pyridine;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
|---|---|
| PubChem CID | 166573947 |
| Molecular Formula | C56H66IrN2OSi-2 |
| Molecular Weight | 1003.46 g/mol |
| Exact Mass | 1003.46 |
| IUPAC Name | 4-cyclohexyl-2-[7-(3,5-ditert-butylphenyl)-3H-dibenzofuran-3-id-4-yl]pyridine;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
| SMILES | CC(C)(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.CC(C)(C)c1cc(-c2ccc3c(c2)oc2c(-c4cc(C5CCCCC5)ccn4)[c-]ccc23)cc(C(C)(C)C)c1.[Ir] |
| InChI | InChI=1S/C37H40NO.C19H26NSi.Ir/c1-36(2,3)28-19-27(20-29(23-28)37(4,5)6)25-15-16-30-31-13-10-14-32(35(31)39-34(30)22-25)33-21-26(17-18-38-33)24-11-8-7-9-12-24;1-19(2,3)13-16-12-17(15-10-8-7-9-11-15)20-14-18(16)21(4,5)6;/h10,13,15-24H,7-9,11-12H2,1-6H3;7-10,12,14H,13H2,1-6H3;/q2*-1; |
| InChIKey | OWAIQGGVASXEBX-UHFFFAOYSA-N |
| XLogP | 15.44 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1003.46 |
| LogP ≤ 5 | 15.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|