C42H46GeIrN2O-2 — CID 155612157
4-cyclohexyl-2-(3H-dibenzofuran-3-id-4-yl)pyridine;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium (PubChem CID 155612157) has the molecular formula C42H46GeIrN2O-2 and a molecular weight of 859.67 g/mol. Its IUPAC name is 4-cyclohexyl-2-(3H-dibenzofuran-3-id-4-yl)pyridine;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium.
| Compound Name | 4-cyclohexyl-2-(3H-dibenzofuran-3-id-4-yl)pyridine;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium |
|---|---|
| PubChem CID | 155612157 |
| Molecular Formula | C42H46GeIrN2O-2 |
| Molecular Weight | 859.67 g/mol |
| Exact Mass | 861.25 |
| IUPAC Name | 4-cyclohexyl-2-(3H-dibenzofuran-3-id-4-yl)pyridine;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium |
| SMILES | CC(C)(C)Cc1cc(-c2[c-]cccc2)ncc1[Ge](C)(C)C.[Ir].[c-]1ccc2c(oc3ccccc32)c1-c1cc(C2CCCCC2)ccn1 |
| InChI | InChI=1S/C23H20NO.C19H26GeN.Ir/c1-2-7-16(8-3-1)17-13-14-24-21(15-17)20-11-6-10-19-18-9-4-5-12-22(18)25-23(19)20;1-19(2,3)13-16-12-18(15-10-8-7-9-11-15)21-14-17(16)20(4,5)6;/h4-6,9-10,12-16H,1-3,7-8H2;7-10,12,14H,13H2,1-6H3;/q2*-1; |
| InChIKey | PNSADYXPAWHHTI-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.67 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|