C49H44GeIrN2O-2 — CID 166577626
4-(1-deuteriocyclohexyl)-2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;iridium;trimethyl-[6-(3-phenylbenzene-6-id-1-yl)-3-pyridinyl]germane (PubChem CID 166577626) has the molecular formula C49H44GeIrN2O-2 and a molecular weight of 942.74 g/mol. Its IUPAC name is 4-(1-deuteriocyclohexyl)-2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;iridium;trimethyl-[6-(3-phenylbenzene-6-id-1-yl)-3-pyridinyl]germane.
| Compound Name | 4-(1-deuteriocyclohexyl)-2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;iridium;trimethyl-[6-(3-phenylbenzene-6-id-1-yl)-3-pyridinyl]germane |
|---|---|
| PubChem CID | 166577626 |
| Molecular Formula | C49H44GeIrN2O-2 |
| Molecular Weight | 942.74 g/mol |
| Exact Mass | 944.24 |
| IUPAC Name | 4-(1-deuteriocyclohexyl)-2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;iridium;trimethyl-[6-(3-phenylbenzene-6-id-1-yl)-3-pyridinyl]germane |
| SMILES | C[Ge](C)(C)c1ccc(-c2[c-]ccc(-c3ccccc3)c2)nc1.[2H]C1(c2ccnc(-c3[c-]ccc4c3oc3cc(-c5ccccc5)ccc34)c2)CCCCC1.[Ir] |
| InChI | InChI=1S/C29H24NO.C20H20GeN.Ir/c1-3-8-20(9-4-1)22-14-15-24-25-12-7-13-26(29(25)31-28(24)19-22)27-18-23(16-17-30-27)21-10-5-2-6-11-21;1-21(2,3)19-12-13-20(22-15-19)18-11-7-10-17(14-18)16-8-5-4-6-9-16;/h1,3-4,7-9,12,14-19,21H,2,5-6,10-11H2;4-10,12-15H,1-3H3;/q2*-1;/i21D;; |
| InChIKey | OTBDNGYICRGDOU-LZNRWZRQSA-N |
| XLogP | 12.92 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.74 |
| LogP ≤ 5 | 12.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|