C46H44GeIrN2O-2 — CID 166577524
4-(2-bicyclo[2.2.2]octanylmethyl)-2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane (PubChem CID 166577524) has the molecular formula C46H44GeIrN2O-2 and a molecular weight of 905.70 g/mol. Its IUPAC name is 4-(2-bicyclo[2.2.2]octanylmethyl)-2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane.
| Compound Name | 4-(2-bicyclo[2.2.2]octanylmethyl)-2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane |
|---|---|
| PubChem CID | 166577524 |
| Molecular Formula | C46H44GeIrN2O-2 |
| Molecular Weight | 905.70 g/mol |
| Exact Mass | 907.23 |
| IUPAC Name | 4-(2-bicyclo[2.2.2]octanylmethyl)-2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane |
| SMILES | C[Ge](C)(C)c1ccc(-c2[c-]cccc2)nc1.[Ir].[c-]1ccc2c(oc3cc(-c4ccccc4)ccc32)c1-c1cc(CC2CC3CCC2CC3)ccn1 |
| InChI | InChI=1S/C32H28NO.C14H16GeN.Ir/c1-2-5-23(6-3-1)25-13-14-27-28-7-4-8-29(32(28)34-31(27)20-25)30-19-22(15-16-33-30)18-26-17-21-9-11-24(26)12-10-21;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h1-7,13-16,19-21,24,26H,9-12,17-18H2;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | SVFCWVXDHXNQRQ-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.70 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|