C39H34GeIrN2O-2 — CID 171730776
iridium;2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)-4,5-bis(trideuteriomethyl)pyridine;trimethyl-(6-phenyl-3-pyridinyl)germane (PubChem CID 171730776) has the molecular formula C39H34GeIrN2O-2 and a molecular weight of 817.58 g/mol. Its IUPAC name is iridium;2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)-4,5-bis(trideuteriomethyl)pyridine;trimethyl-(6-phenyl-3-pyridinyl)germane.
| Compound Name | iridium;2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)-4,5-bis(trideuteriomethyl)pyridine;trimethyl-(6-phenyl-3-pyridinyl)germane |
|---|---|
| PubChem CID | 171730776 |
| Molecular Formula | C39H34GeIrN2O-2 |
| Molecular Weight | 817.58 g/mol |
| Exact Mass | 819.19 |
| IUPAC Name | iridium;2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)-4,5-bis(trideuteriomethyl)pyridine;trimethyl-(6-phenyl-3-pyridinyl)germane |
| SMILES | C[Ge](C)(C)c1ccc(-c2[c-]cccc2)nc1.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2cc(-c4ccccc4)ccc23)cc1C([2H])([2H])[2H].[Ir] |
| InChI | InChI=1S/C25H18NO.C14H16GeN.Ir/c1-16-13-23(26-15-17(16)2)22-10-6-9-21-20-12-11-19(14-24(20)27-25(21)22)18-7-4-3-5-8-18;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h3-9,11-15H,1-2H3;4-7,9-11H,1-3H3;/q2*-1;/i1D3,2D3;; |
| InChIKey | CEEUVKUJVXGRPG-ADBWCSELSA-N |
| XLogP | 9.82 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.58 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|