C49H48F2IrN2OSi-2 — CID 166573476
4-(2-bicyclo[2.2.2]octanylmethyl)-2-[7-(3,5-difluorophenyl)-3H-dibenzofuran-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane (PubChem CID 166573476) has the molecular formula C49H48F2IrN2OSi-2 and a molecular weight of 939.24 g/mol. Its IUPAC name is 4-(2-bicyclo[2.2.2]octanylmethyl)-2-[7-(3,5-difluorophenyl)-3H-dibenzofuran-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane.
| Compound Name | 4-(2-bicyclo[2.2.2]octanylmethyl)-2-[7-(3,5-difluorophenyl)-3H-dibenzofuran-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 166573476 |
| Molecular Formula | C49H48F2IrN2OSi-2 |
| Molecular Weight | 939.24 g/mol |
| Exact Mass | 939.31 |
| IUPAC Name | 4-(2-bicyclo[2.2.2]octanylmethyl)-2-[7-(3,5-difluorophenyl)-3H-dibenzofuran-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane |
| SMILES | CC(C)c1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.Fc1cc(F)cc(-c2ccc3c(c2)oc2c(-c4cc(CC5CC6CCC5CC6)ccn4)[c-]ccc23)c1.[Ir] |
| InChI | InChI=1S/C32H26F2NO.C17H22NSi.Ir/c33-25-15-24(16-26(34)18-25)22-8-9-27-28-2-1-3-29(32(28)36-31(27)17-22)30-14-20(10-11-35-30)13-23-12-19-4-6-21(23)7-5-19;1-13(2)15-11-16(14-9-7-6-8-10-14)18-12-17(15)19(3,4)5;/h1-2,8-11,14-19,21,23H,4-7,12-13H2;6-9,11-13H,1-5H3;/q2*-1; |
| InChIKey | ZIDUSHQDHBOZSH-UHFFFAOYSA-N |
| XLogP | 12.98 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.24 |
| LogP ≤ 5 | 12.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|