C25H23IrN2O- — CID 168799288
iridium;2-phenyl-4-propan-2-ylpyridine;2-pyridin-2-ylphenol (PubChem CID 168799288) has the molecular formula C25H23IrN2O- and a molecular weight of 559.69 g/mol. Its IUPAC name is iridium;2-phenyl-4-propan-2-ylpyridine;2-pyridin-2-ylphenol.
| Compound Name | iridium;2-phenyl-4-propan-2-ylpyridine;2-pyridin-2-ylphenol |
|---|---|
| PubChem CID | 168799288 |
| Molecular Formula | C25H23IrN2O- |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | iridium;2-phenyl-4-propan-2-ylpyridine;2-pyridin-2-ylphenol |
| SMILES | CC(C)c1ccnc(-c2[c-]cccc2)c1.Oc1ccccc1-c1ccccn1.[Ir] |
| InChI | InChI=1S/C14H14N.C11H9NO.Ir/c1-11(2)13-8-9-15-14(10-13)12-6-4-3-5-7-12;13-11-7-2-1-5-9(11)10-6-3-4-8-12-10;/h3-6,8-11H,1-2H3;1-8,13H;/q-1;; |
| InChIKey | MCKRVNIOIUPGDP-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|