C31H28IrN2S-2 — CID 170518880
iridium;2-phenylpyridine;4-propan-2-yl-2-(6,7,8,9-tetrahydro-3H-dibenzothiophen-3-id-4-yl)pyridine (PubChem CID 170518880) has the molecular formula C31H28IrN2S-2 and a molecular weight of 652.86 g/mol. Its IUPAC name is iridium;2-phenylpyridine;4-propan-2-yl-2-(6,7,8,9-tetrahydro-3H-dibenzothiophen-3-id-4-yl)pyridine.
| Compound Name | iridium;2-phenylpyridine;4-propan-2-yl-2-(6,7,8,9-tetrahydro-3H-dibenzothiophen-3-id-4-yl)pyridine |
|---|---|
| PubChem CID | 170518880 |
| Molecular Formula | C31H28IrN2S-2 |
| Molecular Weight | 652.86 g/mol |
| Exact Mass | 653.16 |
| IUPAC Name | iridium;2-phenylpyridine;4-propan-2-yl-2-(6,7,8,9-tetrahydro-3H-dibenzothiophen-3-id-4-yl)pyridine |
| SMILES | CC(C)c1ccnc(-c2[c-]ccc3c4c(sc23)CCCC4)c1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C20H20NS.C11H8N.Ir/c1-13(2)14-10-11-21-18(12-14)17-8-5-7-16-15-6-3-4-9-19(15)22-20(16)17;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h5,7,10-13H,3-4,6,9H2,1-2H3;1-6,8-9H;/q2*-1; |
| InChIKey | DZDYZFDJTRJXRX-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.86 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|