C34H32IrN2SSi-2 — CID 155608718
iridium;2-phenyl-5-propan-2-ylpyridine;trimethyl-(6-pyridin-2-yl-7H-dibenzothiophen-7-id-3-yl)silane (PubChem CID 155608718) has the molecular formula C34H32IrN2SSi-2 and a molecular weight of 721.01 g/mol. Its IUPAC name is iridium;2-phenyl-5-propan-2-ylpyridine;trimethyl-(6-pyridin-2-yl-7H-dibenzothiophen-7-id-3-yl)silane.
| Compound Name | iridium;2-phenyl-5-propan-2-ylpyridine;trimethyl-(6-pyridin-2-yl-7H-dibenzothiophen-7-id-3-yl)silane |
|---|---|
| PubChem CID | 155608718 |
| Molecular Formula | C34H32IrN2SSi-2 |
| Molecular Weight | 721.01 g/mol |
| Exact Mass | 721.17 |
| IUPAC Name | iridium;2-phenyl-5-propan-2-ylpyridine;trimethyl-(6-pyridin-2-yl-7H-dibenzothiophen-7-id-3-yl)silane |
| SMILES | CC(C)c1ccc(-c2[c-]cccc2)nc1.C[Si](C)(C)c1ccc2c(c1)sc1c(-c3ccccn3)[c-]ccc12.[Ir] |
| InChI | InChI=1S/C20H18NSSi.C14H14N.Ir/c1-23(2,3)14-10-11-15-16-7-6-8-17(18-9-4-5-12-21-18)20(16)22-19(15)13-14;1-11(2)13-8-9-14(15-10-13)12-6-4-3-5-7-12;/h4-7,9-13H,1-3H3;3-6,8-11H,1-2H3;/q2*-1; |
| InChIKey | CUXPPVMSAHCFKK-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.01 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|