C32H28IrN2SSi-2 — CID 155608412
iridium;2-phenylpyridine;trimethyl-[6-(5-methyl-2-pyridinyl)-7H-dibenzothiophen-7-id-3-yl]silane (PubChem CID 155608412) has the molecular formula C32H28IrN2SSi-2 and a molecular weight of 692.96 g/mol. Its IUPAC name is iridium;2-phenylpyridine;trimethyl-[6-(5-methyl-2-pyridinyl)-7H-dibenzothiophen-7-id-3-yl]silane.
| Compound Name | iridium;2-phenylpyridine;trimethyl-[6-(5-methyl-2-pyridinyl)-7H-dibenzothiophen-7-id-3-yl]silane |
|---|---|
| PubChem CID | 155608412 |
| Molecular Formula | C32H28IrN2SSi-2 |
| Molecular Weight | 692.96 g/mol |
| Exact Mass | 693.14 |
| IUPAC Name | iridium;2-phenylpyridine;trimethyl-[6-(5-methyl-2-pyridinyl)-7H-dibenzothiophen-7-id-3-yl]silane |
| SMILES | Cc1ccc(-c2[c-]ccc3c2sc2cc([Si](C)(C)C)ccc23)nc1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C21H20NSSi.C11H8N.Ir/c1-14-8-11-19(22-13-14)18-7-5-6-17-16-10-9-15(24(2,3)4)12-20(16)23-21(17)18;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h5-6,8-13H,1-4H3;1-6,8-9H;/q2*-1; |
| InChIKey | GOTFMQLTNJTIDF-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.96 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|