C40H42IrN2SSi-2 — CID 155608738
[6-(4-cyclohexyl-2-pyridinyl)-7H-dibenzothiophen-7-id-3-yl]-trimethylsilane;iridium;2-phenyl-5-propan-2-ylpyridine (PubChem CID 155608738) has the molecular formula C40H42IrN2SSi-2 and a molecular weight of 803.16 g/mol. Its IUPAC name is [6-(4-cyclohexyl-2-pyridinyl)-7H-dibenzothiophen-7-id-3-yl]-trimethylsilane;iridium;2-phenyl-5-propan-2-ylpyridine.
| Compound Name | [6-(4-cyclohexyl-2-pyridinyl)-7H-dibenzothiophen-7-id-3-yl]-trimethylsilane;iridium;2-phenyl-5-propan-2-ylpyridine |
|---|---|
| PubChem CID | 155608738 |
| Molecular Formula | C40H42IrN2SSi-2 |
| Molecular Weight | 803.16 g/mol |
| Exact Mass | 803.25 |
| IUPAC Name | [6-(4-cyclohexyl-2-pyridinyl)-7H-dibenzothiophen-7-id-3-yl]-trimethylsilane;iridium;2-phenyl-5-propan-2-ylpyridine |
| SMILES | CC(C)c1ccc(-c2[c-]cccc2)nc1.C[Si](C)(C)c1ccc2c(c1)sc1c(-c3cc(C4CCCCC4)ccn3)[c-]ccc12.[Ir] |
| InChI | InChI=1S/C26H28NSSi.C14H14N.Ir/c1-29(2,3)20-12-13-21-22-10-7-11-23(26(22)28-25(21)17-20)24-16-19(14-15-27-24)18-8-5-4-6-9-18;1-11(2)13-8-9-14(15-10-13)12-6-4-3-5-7-12;/h7,10,12-18H,4-6,8-9H2,1-3H3;3-6,8-11H,1-2H3;/q2*-1; |
| InChIKey | UTBDGAGCMORBEL-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.16 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|