C34H25IrN3OS-2 — CID 168828653
iridium;2-phenylpyridine;8-(6,7,8,9-tetrahydro-[1]benzothiolo[3,2-c]pyridin-3-yl)-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide (PubChem CID 168828653) has the molecular formula C34H25IrN3OS-2 and a molecular weight of 718.90 g/mol. Its IUPAC name is iridium;2-phenylpyridine;8-(6,7,8,9-tetrahydro-[1]benzothiolo[3,2-c]pyridin-3-yl)-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide.
| Compound Name | iridium;2-phenylpyridine;8-(6,7,8,9-tetrahydro-[1]benzothiolo[3,2-c]pyridin-3-yl)-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide |
|---|---|
| PubChem CID | 168828653 |
| Molecular Formula | C34H25IrN3OS-2 |
| Molecular Weight | 718.90 g/mol |
| Exact Mass | 719.15 |
| IUPAC Name | iridium;2-phenylpyridine;8-(6,7,8,9-tetrahydro-[1]benzothiolo[3,2-c]pyridin-3-yl)-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide |
| SMILES | [2H]C([2H])([2H])c1ccc2c(n1)oc1c(-c3cc4sc5c(c4cn3)CCCC5)[c-]ccc12.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C23H17N2OS.C11H8N.Ir/c1-13-9-10-16-15-6-4-7-17(22(15)26-23(16)25-13)19-11-21-18(12-24-19)14-5-2-3-8-20(14)27-21;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h4,6,9-12H,2-3,5,8H2,1H3;1-6,8-9H;/q2*-1;/i1D3;; |
| InChIKey | ORFKVWLSALCJNJ-GXXYEPOPSA-N |
| XLogP | 8.79 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.90 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|