C32H23IrN3OS-2 — CID 168828132
8-(2,3-dimethylthieno[2,3-c]pyridin-5-yl)-2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;2-phenylpyridine (PubChem CID 168828132) has the molecular formula C32H23IrN3OS-2 and a molecular weight of 689.84 g/mol. Its IUPAC name is 8-(2,3-dimethylthieno[2,3-c]pyridin-5-yl)-2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;2-phenylpyridine.
| Compound Name | 8-(2,3-dimethylthieno[2,3-c]pyridin-5-yl)-2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 168828132 |
| Molecular Formula | C32H23IrN3OS-2 |
| Molecular Weight | 689.84 g/mol |
| Exact Mass | 690.12 |
| IUPAC Name | 8-(2,3-dimethylthieno[2,3-c]pyridin-5-yl)-2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;2-phenylpyridine |
| SMILES | Cc1ccc2c(n1)oc1c(-c3cc4c(C)c(C)sc4cn3)[c-]ccc12.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C21H15N2OS.C11H8N.Ir/c1-11-7-8-15-14-5-4-6-16(20(14)24-21(15)23-11)18-9-17-12(2)13(3)25-19(17)10-22-18;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h4-5,7-10H,1-3H3;1-6,8-9H;/q2*-1; |
| InChIKey | GTHHGJMURDSWMC-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.84 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|