C39H42GeIrN2O-2 — CID 162776831
iridium;2-(8-propan-2-yl-3H-dibenzofuran-3-id-2-yl)pyridine;trimethyl-[4-(2-methylbutyl)-6-phenyl-3-pyridinyl]germane (PubChem CID 162776831) has the molecular formula C39H42GeIrN2O-2 and a molecular weight of 819.60 g/mol. Its IUPAC name is iridium;2-(8-propan-2-yl-3H-dibenzofuran-3-id-2-yl)pyridine;trimethyl-[4-(2-methylbutyl)-6-phenyl-3-pyridinyl]germane.
| Compound Name | iridium;2-(8-propan-2-yl-3H-dibenzofuran-3-id-2-yl)pyridine;trimethyl-[4-(2-methylbutyl)-6-phenyl-3-pyridinyl]germane |
|---|---|
| PubChem CID | 162776831 |
| Molecular Formula | C39H42GeIrN2O-2 |
| Molecular Weight | 819.60 g/mol |
| Exact Mass | 821.21 |
| IUPAC Name | iridium;2-(8-propan-2-yl-3H-dibenzofuran-3-id-2-yl)pyridine;trimethyl-[4-(2-methylbutyl)-6-phenyl-3-pyridinyl]germane |
| SMILES | CC(C)c1ccc2oc3c[c-]c(-c4ccccn4)cc3c2c1.CCC(C)Cc1cc(-c2[c-]cccc2)ncc1[Ge](C)(C)C.[Ir] |
| InChI | InChI=1S/C20H16NO.C19H26GeN.Ir/c1-13(2)14-6-8-19-16(11-14)17-12-15(7-9-20(17)22-19)18-5-3-4-10-21-18;1-6-15(2)12-17-13-19(16-10-8-7-9-11-16)21-14-18(17)20(3,4)5;/h3-6,8-13H,1-2H3;7-10,13-15H,6,12H2,1-5H3;/q2*-1; |
| InChIKey | QFVFBEFHTZGOBV-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.60 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|