C41H28IrN2O-2 — CID 162707908
4-benzyl-2-(8-phenyl-3H-dibenzofuran-3-id-2-yl)pyridine;iridium;2-phenylpyridine (PubChem CID 162707908) has the molecular formula C41H28IrN2O-2 and a molecular weight of 756.91 g/mol. Its IUPAC name is 4-benzyl-2-(8-phenyl-3H-dibenzofuran-3-id-2-yl)pyridine;iridium;2-phenylpyridine.
| Compound Name | 4-benzyl-2-(8-phenyl-3H-dibenzofuran-3-id-2-yl)pyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 162707908 |
| Molecular Formula | C41H28IrN2O-2 |
| Molecular Weight | 756.91 g/mol |
| Exact Mass | 757.18 |
| IUPAC Name | 4-benzyl-2-(8-phenyl-3H-dibenzofuran-3-id-2-yl)pyridine;iridium;2-phenylpyridine |
| SMILES | [Ir].[c-]1cc2oc3ccc(-c4ccccc4)cc3c2cc1-c1cc(Cc2ccccc2)ccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C30H20NO.C11H8N.Ir/c1-3-7-21(8-4-1)17-22-15-16-31-28(18-22)25-12-14-30-27(20-25)26-19-24(11-13-29(26)32-30)23-9-5-2-6-10-23;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-11,13-16,18-20H,17H2;1-6,8-9H;/q2*-1; |
| InChIKey | VNZXUMOWDONVPC-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.91 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|