C50H46IrN2OSi-2 — CID 166577988
(4-benzyl-6-phenyl-3-pyridinyl)-trimethylsilane;4-(cyclopentylmethyl)-2-(8-phenyl-2H-dibenzofuran-2-id-3-yl)pyridine;iridium (PubChem CID 166577988) has the molecular formula C50H46IrN2OSi-2 and a molecular weight of 911.23 g/mol. Its IUPAC name is (4-benzyl-6-phenyl-3-pyridinyl)-trimethylsilane;4-(cyclopentylmethyl)-2-(8-phenyl-2H-dibenzofuran-2-id-3-yl)pyridine;iridium.
| Compound Name | (4-benzyl-6-phenyl-3-pyridinyl)-trimethylsilane;4-(cyclopentylmethyl)-2-(8-phenyl-2H-dibenzofuran-2-id-3-yl)pyridine;iridium |
|---|---|
| PubChem CID | 166577988 |
| Molecular Formula | C50H46IrN2OSi-2 |
| Molecular Weight | 911.23 g/mol |
| Exact Mass | 911.30 |
| IUPAC Name | (4-benzyl-6-phenyl-3-pyridinyl)-trimethylsilane;4-(cyclopentylmethyl)-2-(8-phenyl-2H-dibenzofuran-2-id-3-yl)pyridine;iridium |
| SMILES | C[Si](C)(C)c1cnc(-c2[c-]cccc2)cc1Cc1ccccc1.[Ir].[c-]1cc2c(cc1-c1cc(CC3CCCC3)ccn1)oc1ccc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C29H24NO.C21H22NSi.Ir/c1-2-8-22(9-3-1)23-11-13-28-26(18-23)25-12-10-24(19-29(25)31-28)27-17-21(14-15-30-27)16-20-6-4-5-7-20;1-23(2,3)21-16-22-20(18-12-8-5-9-13-18)15-19(21)14-17-10-6-4-7-11-17;/h1-3,8-9,11-15,17-20H,4-7,16H2;4-12,15-16H,14H2,1-3H3;/q2*-1; |
| InChIKey | IHHCWTZYIRNWDF-UHFFFAOYSA-N |
| XLogP | 12.53 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.23 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|