C49H42IrN2O-2 — CID 162710449
4-[cyclopentyl(dideuterio)methyl]-2-(8-phenyl-3H-dibenzofuran-3-id-2-yl)pyridine;iridium;2-phenyl-4-(2-phenylpropan-2-yl)pyridine (PubChem CID 162710449) has the molecular formula C49H42IrN2O-2 and a molecular weight of 869.12 g/mol. Its IUPAC name is 4-[cyclopentyl(dideuterio)methyl]-2-(8-phenyl-3H-dibenzofuran-3-id-2-yl)pyridine;iridium;2-phenyl-4-(2-phenylpropan-2-yl)pyridine.
| Compound Name | 4-[cyclopentyl(dideuterio)methyl]-2-(8-phenyl-3H-dibenzofuran-3-id-2-yl)pyridine;iridium;2-phenyl-4-(2-phenylpropan-2-yl)pyridine |
|---|---|
| PubChem CID | 162710449 |
| Molecular Formula | C49H42IrN2O-2 |
| Molecular Weight | 869.12 g/mol |
| Exact Mass | 869.31 |
| IUPAC Name | 4-[cyclopentyl(dideuterio)methyl]-2-(8-phenyl-3H-dibenzofuran-3-id-2-yl)pyridine;iridium;2-phenyl-4-(2-phenylpropan-2-yl)pyridine |
| SMILES | CC(C)(c1ccccc1)c1ccnc(-c2[c-]cccc2)c1.[2H]C([2H])(c1ccnc(-c2[c-]cc3oc4ccc(-c5ccccc5)cc4c3c2)c1)C1CCCC1.[Ir] |
| InChI | InChI=1S/C29H24NO.C20H18N.Ir/c1-2-8-22(9-3-1)23-10-12-28-25(18-23)26-19-24(11-13-29(26)31-28)27-17-21(14-15-30-27)16-20-6-4-5-7-20;1-20(2,17-11-7-4-8-12-17)18-13-14-21-19(15-18)16-9-5-3-6-10-16;/h1-3,8-10,12-15,17-20H,4-7,16H2;3-9,11-15H,1-2H3;/q2*-1;/i16D2;; |
| InChIKey | UXSMVXIVCNBLKM-LCJVVBFUSA-N |
| XLogP | 12.72 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.12 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|