C41H37GeIrN2O-2 — CID 167332233
CID 167332233 (PubChem CID 167332233) has the molecular formula C41H37GeIrN2O-2 and a molecular weight of 838.59 g/mol.
| Compound Name | CID 167332233 |
|---|---|
| PubChem CID | 167332233 |
| Molecular Formula | C41H37GeIrN2O-2 |
| Molecular Weight | 838.59 g/mol |
| Exact Mass | 840.18 |
| IUPAC Name | — |
| SMILES | CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Ge](C)C.Cc1ccnc(-c2[c-]cc3oc4ccc(-c5ccccc5)cc4c3c2)c1.[Ir] |
| InChI | InChI=1S/C24H16NO.C17H21GeN.Ir/c1-16-11-12-25-22(13-16)19-8-10-24-21(15-19)20-14-18(7-9-23(20)26-24)17-5-3-2-4-6-17;1-13(2)10-15-11-17(14-8-6-5-7-9-14)19-12-16(15)18(3)4;/h2-7,9-15H,1H3;5-8,11-13H,10H2,1-4H3;/q2*-1; |
| InChIKey | JXCSPTVOTDJLLG-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.59 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|