C36H27FIrN2-2 — CID 162707124
2-(4-fluorobenzene-6-id-1-yl)-5-(1-phenylethyl)pyridine;iridium;4-phenyl-2-phenylpyridine (PubChem CID 162707124) has the molecular formula C36H27FIrN2-2 and a molecular weight of 698.84 g/mol. Its IUPAC name is 2-(4-fluorobenzene-6-id-1-yl)-5-(1-phenylethyl)pyridine;iridium;4-phenyl-2-phenylpyridine.
| Compound Name | 2-(4-fluorobenzene-6-id-1-yl)-5-(1-phenylethyl)pyridine;iridium;4-phenyl-2-phenylpyridine |
|---|---|
| PubChem CID | 162707124 |
| Molecular Formula | C36H27FIrN2-2 |
| Molecular Weight | 698.84 g/mol |
| Exact Mass | 699.18 |
| IUPAC Name | 2-(4-fluorobenzene-6-id-1-yl)-5-(1-phenylethyl)pyridine;iridium;4-phenyl-2-phenylpyridine |
| SMILES | CC(c1ccccc1)c1ccc(-c2[c-]cc(F)cc2)nc1.[Ir].[c-]1ccccc1-c1cc(-c2ccccc2)ccn1 |
| InChI | InChI=1S/C19H15FN.C17H12N.Ir/c1-14(15-5-3-2-4-6-15)17-9-12-19(21-13-17)16-7-10-18(20)11-8-16;1-3-7-14(8-4-1)16-11-12-18-17(13-16)15-9-5-2-6-10-15;/h2-7,9-14H,1H3;1-9,11-13H;/q2*-1; |
| InChIKey | XLPMDWYRDGZDHA-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.84 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|