C33H25FIrN2O2Si-2 — CID 176584107
2-(2H-dibenzofuran-2-id-1-yl)-1,3-benzoxazole;[6-(4-fluorobenzene-6-id-1-yl)-3-pyridinyl]-trimethylsilane;iridium (PubChem CID 176584107) has the molecular formula C33H25FIrN2O2Si-2 and a molecular weight of 720.88 g/mol. Its IUPAC name is 2-(2H-dibenzofuran-2-id-1-yl)-1,3-benzoxazole;[6-(4-fluorobenzene-6-id-1-yl)-3-pyridinyl]-trimethylsilane;iridium.
| Compound Name | 2-(2H-dibenzofuran-2-id-1-yl)-1,3-benzoxazole;[6-(4-fluorobenzene-6-id-1-yl)-3-pyridinyl]-trimethylsilane;iridium |
|---|---|
| PubChem CID | 176584107 |
| Molecular Formula | C33H25FIrN2O2Si-2 |
| Molecular Weight | 720.88 g/mol |
| Exact Mass | 721.13 |
| IUPAC Name | 2-(2H-dibenzofuran-2-id-1-yl)-1,3-benzoxazole;[6-(4-fluorobenzene-6-id-1-yl)-3-pyridinyl]-trimethylsilane;iridium |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cc(F)cc2)nc1.[Ir].[c-]1ccc2oc3ccccc3c2c1-c1nc2ccccc2o1 |
| InChI | InChI=1S/C19H10NO2.C14H15FNSi.Ir/c1-3-9-15-12(6-1)18-13(7-5-11-17(18)21-15)19-20-14-8-2-4-10-16(14)22-19;1-17(2,3)13-8-9-14(16-10-13)11-4-6-12(15)7-5-11;/h1-6,8-11H;4,6-10H,1-3H3;/q2*-1; |
| InChIKey | IOKXELAMXWPLBY-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.88 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|