C38H31FIrN2SSi-2 — CID 164712128
2-(3H-dibenzothiophen-3-id-4-yl)-4-methyl-5-phenylpyridine;[6-(4-fluorobenzene-6-id-1-yl)-3-pyridinyl]-trimethylsilane;iridium (PubChem CID 164712128) has the molecular formula C38H31FIrN2SSi-2 and a molecular weight of 787.05 g/mol. Its IUPAC name is 2-(3H-dibenzothiophen-3-id-4-yl)-4-methyl-5-phenylpyridine;[6-(4-fluorobenzene-6-id-1-yl)-3-pyridinyl]-trimethylsilane;iridium.
| Compound Name | 2-(3H-dibenzothiophen-3-id-4-yl)-4-methyl-5-phenylpyridine;[6-(4-fluorobenzene-6-id-1-yl)-3-pyridinyl]-trimethylsilane;iridium |
|---|---|
| PubChem CID | 164712128 |
| Molecular Formula | C38H31FIrN2SSi-2 |
| Molecular Weight | 787.05 g/mol |
| Exact Mass | 787.16 |
| IUPAC Name | 2-(3H-dibenzothiophen-3-id-4-yl)-4-methyl-5-phenylpyridine;[6-(4-fluorobenzene-6-id-1-yl)-3-pyridinyl]-trimethylsilane;iridium |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cc(F)cc2)nc1.Cc1cc(-c2[c-]ccc3c2sc2ccccc23)ncc1-c1ccccc1.[Ir] |
| InChI | InChI=1S/C24H16NS.C14H15FNSi.Ir/c1-16-14-22(25-15-21(16)17-8-3-2-4-9-17)20-12-7-11-19-18-10-5-6-13-23(18)26-24(19)20;1-17(2,3)13-8-9-14(16-10-13)11-4-6-12(15)7-5-11;/h2-11,13-15H,1H3;4,6-10H,1-3H3;/q2*-1; |
| InChIKey | SCOPSVJSHRKSTB-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.05 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|