C40H35FIrN2SSi-2 — CID 164711681
2-(9-fluoro-3H-dibenzothiophen-3-id-4-yl)-4-(2,4,6-trimethylphenyl)pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane (PubChem CID 164711681) has the molecular formula C40H35FIrN2SSi-2 and a molecular weight of 815.10 g/mol. Its IUPAC name is 2-(9-fluoro-3H-dibenzothiophen-3-id-4-yl)-4-(2,4,6-trimethylphenyl)pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane.
| Compound Name | 2-(9-fluoro-3H-dibenzothiophen-3-id-4-yl)-4-(2,4,6-trimethylphenyl)pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 164711681 |
| Molecular Formula | C40H35FIrN2SSi-2 |
| Molecular Weight | 815.10 g/mol |
| Exact Mass | 815.19 |
| IUPAC Name | 2-(9-fluoro-3H-dibenzothiophen-3-id-4-yl)-4-(2,4,6-trimethylphenyl)pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.Cc1cc(C)c(-c2ccnc(-c3[c-]ccc4c3sc3cccc(F)c34)c2)c(C)c1.[Ir] |
| InChI | InChI=1S/C26H19FNS.C14H16NSi.Ir/c1-15-12-16(2)24(17(3)13-15)18-10-11-28-22(14-18)19-6-4-7-20-25-21(27)8-5-9-23(25)29-26(19)20;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h4-5,7-14H,1-3H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | VZXSLYZZCWBJLK-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.10 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|