C49H50IrN2SSi-2 — CID 166578668
4-(2-bicyclo[2.2.2]octanylmethyl)-2-[7-(2,4,6-trimethylphenyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane (PubChem CID 166578668) has the molecular formula C49H50IrN2SSi-2 and a molecular weight of 919.32 g/mol. Its IUPAC name is 4-(2-bicyclo[2.2.2]octanylmethyl)-2-[7-(2,4,6-trimethylphenyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane.
| Compound Name | 4-(2-bicyclo[2.2.2]octanylmethyl)-2-[7-(2,4,6-trimethylphenyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 166578668 |
| Molecular Formula | C49H50IrN2SSi-2 |
| Molecular Weight | 919.32 g/mol |
| Exact Mass | 919.31 |
| IUPAC Name | 4-(2-bicyclo[2.2.2]octanylmethyl)-2-[7-(2,4,6-trimethylphenyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.Cc1cc(C)c(-c2ccc3c(c2)sc2c(-c4cc(CC5CC6CCC5CC6)ccn4)[c-]ccc23)c(C)c1.[Ir] |
| InChI | InChI=1S/C35H34NS.C14H16NSi.Ir/c1-21-15-22(2)34(23(3)16-21)27-11-12-29-30-5-4-6-31(35(30)37-33(29)20-27)32-19-25(13-14-36-32)18-28-17-24-7-9-26(28)10-8-24;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h4-5,11-16,19-20,24,26,28H,7-10,17-18H2,1-3H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | QCEMANUSNVPRRA-UHFFFAOYSA-N |
| XLogP | 12.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.32 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|