C51H54IrN2SSi-2 — CID 166576201
4-(2-bicyclo[2.2.2]octanylmethyl)-2-(9-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium (PubChem CID 166576201) has the molecular formula C51H54IrN2SSi-2 and a molecular weight of 947.38 g/mol. Its IUPAC name is 4-(2-bicyclo[2.2.2]octanylmethyl)-2-(9-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium.
| Compound Name | 4-(2-bicyclo[2.2.2]octanylmethyl)-2-(9-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
|---|---|
| PubChem CID | 166576201 |
| Molecular Formula | C51H54IrN2SSi-2 |
| Molecular Weight | 947.38 g/mol |
| Exact Mass | 947.34 |
| IUPAC Name | 4-(2-bicyclo[2.2.2]octanylmethyl)-2-(9-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
| SMILES | CC(C)(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.[Ir].[c-]1ccc2c(sc3cccc(-c4ccccc4)c32)c1-c1cc(CC2CC3CCC2CC3)ccn1 |
| InChI | InChI=1S/C32H28NS.C19H26NSi.Ir/c1-2-6-24(7-3-1)26-8-5-11-30-31(26)28-10-4-9-27(32(28)34-30)29-20-22(16-17-33-29)19-25-18-21-12-14-23(25)15-13-21;1-19(2,3)13-16-12-17(15-10-8-7-9-11-15)20-14-18(16)21(4,5)6;/h1-8,10-11,16-17,20-21,23,25H,12-15,18-19H2;7-10,12,14H,13H2,1-6H3;/q2*-1; |
| InChIKey | UGVLXNHBLLOGEL-UHFFFAOYSA-N |
| XLogP | 13.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.38 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|