C46H39FIrN2SSi-2 — CID 164711663
2-(1-fluoro-3H-dibenzothiophen-3-id-4-yl)-4-(2,4,6-trimethylphenyl)pyridine;iridium;trimethyl-(4-phenyl-6-phenyl-3-pyridinyl)silane (PubChem CID 164711663) has the molecular formula C46H39FIrN2SSi-2 and a molecular weight of 891.20 g/mol. Its IUPAC name is 2-(1-fluoro-3H-dibenzothiophen-3-id-4-yl)-4-(2,4,6-trimethylphenyl)pyridine;iridium;trimethyl-(4-phenyl-6-phenyl-3-pyridinyl)silane.
| Compound Name | 2-(1-fluoro-3H-dibenzothiophen-3-id-4-yl)-4-(2,4,6-trimethylphenyl)pyridine;iridium;trimethyl-(4-phenyl-6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 164711663 |
| Molecular Formula | C46H39FIrN2SSi-2 |
| Molecular Weight | 891.20 g/mol |
| Exact Mass | 891.22 |
| IUPAC Name | 2-(1-fluoro-3H-dibenzothiophen-3-id-4-yl)-4-(2,4,6-trimethylphenyl)pyridine;iridium;trimethyl-(4-phenyl-6-phenyl-3-pyridinyl)silane |
| SMILES | C[Si](C)(C)c1cnc(-c2[c-]cccc2)cc1-c1ccccc1.Cc1cc(C)c(-c2ccnc(-c3[c-]cc(F)c4c3sc3ccccc34)c2)c(C)c1.[Ir] |
| InChI | InChI=1S/C26H19FNS.C20H20NSi.Ir/c1-15-12-16(2)24(17(3)13-15)18-10-11-28-22(14-18)19-8-9-21(27)25-20-6-4-5-7-23(20)29-26(19)25;1-22(2,3)20-15-21-19(17-12-8-5-9-13-17)14-18(20)16-10-6-4-7-11-16;/h4-7,9-14H,1-3H3;4-12,14-15H,1-3H3;/q2*-1; |
| InChIKey | BODQVCLDFOALJL-UHFFFAOYSA-N |
| XLogP | 12.41 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.20 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|