C45H38FIrN3OSi-2 — CID 164712802
4-fluoro-8-[4-(2,4,6-trimethylphenyl)-2-pyridinyl]-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(4-phenyl-6-phenyl-3-pyridinyl)silane (PubChem CID 164712802) has the molecular formula C45H38FIrN3OSi-2 and a molecular weight of 876.12 g/mol. Its IUPAC name is 4-fluoro-8-[4-(2,4,6-trimethylphenyl)-2-pyridinyl]-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(4-phenyl-6-phenyl-3-pyridinyl)silane.
| Compound Name | 4-fluoro-8-[4-(2,4,6-trimethylphenyl)-2-pyridinyl]-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(4-phenyl-6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 164712802 |
| Molecular Formula | C45H38FIrN3OSi-2 |
| Molecular Weight | 876.12 g/mol |
| Exact Mass | 876.24 |
| IUPAC Name | 4-fluoro-8-[4-(2,4,6-trimethylphenyl)-2-pyridinyl]-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(4-phenyl-6-phenyl-3-pyridinyl)silane |
| SMILES | C[Si](C)(C)c1cnc(-c2[c-]cccc2)cc1-c1ccccc1.Cc1cc(C)c(-c2ccnc(-c3[c-]ccc4c3oc3nccc(F)c34)c2)c(C)c1.[Ir] |
| InChI | InChI=1S/C25H18FN2O.C20H20NSi.Ir/c1-14-11-15(2)22(16(3)12-14)17-7-9-27-21(13-17)18-5-4-6-19-23-20(26)8-10-28-25(23)29-24(18)19;1-22(2,3)20-15-21-19(17-12-8-5-9-13-17)14-18(20)16-10-6-4-7-11-16;/h4,6-13H,1-3H3;4-12,14-15H,1-3H3;/q2*-1; |
| InChIKey | QHYFJCXMSIGXRP-UHFFFAOYSA-N |
| XLogP | 11.33 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.12 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|