C46H46GeIrN2S-2 — CID 166577448
4-(2-cyclopentylpropan-2-yl)-2-(1-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine;iridium;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)germane (PubChem CID 166577448) has the molecular formula C46H46GeIrN2S-2 and a molecular weight of 923.78 g/mol. Its IUPAC name is 4-(2-cyclopentylpropan-2-yl)-2-(1-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine;iridium;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)germane.
| Compound Name | 4-(2-cyclopentylpropan-2-yl)-2-(1-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine;iridium;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)germane |
|---|---|
| PubChem CID | 166577448 |
| Molecular Formula | C46H46GeIrN2S-2 |
| Molecular Weight | 923.78 g/mol |
| Exact Mass | 925.22 |
| IUPAC Name | 4-(2-cyclopentylpropan-2-yl)-2-(1-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine;iridium;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)germane |
| SMILES | CC(C)(c1ccnc(-c2[c-]cc(-c3ccccc3)c3c2sc2ccccc23)c1)C1CCCC1.Cc1cc(-c2[c-]cccc2)ncc1[Ge](C)(C)C.[Ir] |
| InChI | InChI=1S/C31H28NS.C15H18GeN.Ir/c1-31(2,22-12-6-7-13-22)23-18-19-32-27(20-23)25-17-16-24(21-10-4-3-5-11-21)29-26-14-8-9-15-28(26)33-30(25)29;1-12-10-15(13-8-6-5-7-9-13)17-11-14(12)16(2,3)4;/h3-5,8-11,14-16,18-20,22H,6-7,12-13H2,1-2H3;5-8,10-11H,1-4H3;/q2*-1; |
| InChIKey | SVVNUOBMTSYLGE-UHFFFAOYSA-N |
| XLogP | 12.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.78 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|