C49H52IrN2SSi-2 — CID 166575437
4-(2-cyclopentylpropan-2-yl)-2-(1-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane (PubChem CID 166575437) has the molecular formula C49H52IrN2SSi-2 and a molecular weight of 921.34 g/mol. Its IUPAC name is 4-(2-cyclopentylpropan-2-yl)-2-(1-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane.
| Compound Name | 4-(2-cyclopentylpropan-2-yl)-2-(1-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
|---|---|
| PubChem CID | 166575437 |
| Molecular Formula | C49H52IrN2SSi-2 |
| Molecular Weight | 921.34 g/mol |
| Exact Mass | 921.33 |
| IUPAC Name | 4-(2-cyclopentylpropan-2-yl)-2-(1-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
| SMILES | CC(C)(c1ccnc(-c2[c-]cc(-c3ccccc3)c3c2sc2ccccc23)c1)C1CCCC1.CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.[Ir] |
| InChI | InChI=1S/C31H28NS.C18H24NSi.Ir/c1-31(2,22-12-6-7-13-22)23-18-19-32-27(20-23)25-17-16-24(21-10-4-3-5-11-21)29-26-14-8-9-15-28(26)33-30(25)29;1-14(2)11-16-12-17(15-9-7-6-8-10-15)19-13-18(16)20(3,4)5;/h3-5,8-11,14-16,18-20,22H,6-7,12-13H2,1-2H3;6-9,12-14H,11H2,1-5H3;/q2*-1; |
| InChIKey | CEKWHMBJCDCIBZ-UHFFFAOYSA-N |
| XLogP | 13.34 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.34 |
| LogP ≤ 5 | 13.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|