C50H54IrN2OSi-2 — CID 166577128
4-(2-cyclopentylpropan-2-yl)-2-(9-phenyl-3H-dibenzofuran-3-id-2-yl)pyridine;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium (PubChem CID 166577128) has the molecular formula C50H54IrN2OSi-2 and a molecular weight of 919.30 g/mol. Its IUPAC name is 4-(2-cyclopentylpropan-2-yl)-2-(9-phenyl-3H-dibenzofuran-3-id-2-yl)pyridine;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium.
| Compound Name | 4-(2-cyclopentylpropan-2-yl)-2-(9-phenyl-3H-dibenzofuran-3-id-2-yl)pyridine;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
|---|---|
| PubChem CID | 166577128 |
| Molecular Formula | C50H54IrN2OSi-2 |
| Molecular Weight | 919.30 g/mol |
| Exact Mass | 919.36 |
| IUPAC Name | 4-(2-cyclopentylpropan-2-yl)-2-(9-phenyl-3H-dibenzofuran-3-id-2-yl)pyridine;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
| SMILES | CC(C)(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.CC(C)(c1ccnc(-c2[c-]cc3oc4cccc(-c5ccccc5)c4c3c2)c1)C1CCCC1.[Ir] |
| InChI | InChI=1S/C31H28NO.C19H26NSi.Ir/c1-31(2,23-11-6-7-12-23)24-17-18-32-27(20-24)22-15-16-28-26(19-22)30-25(13-8-14-29(30)33-28)21-9-4-3-5-10-21;1-19(2,3)13-16-12-17(15-10-8-7-9-11-15)20-14-18(16)21(4,5)6;/h3-5,8-10,13-14,16-20,23H,6-7,11-12H2,1-2H3;7-10,12,14H,13H2,1-6H3;/q2*-1; |
| InChIKey | AECTVUVECRYQTB-UHFFFAOYSA-N |
| XLogP | 13.26 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.30 |
| LogP ≤ 5 | 13.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|