C43H42IrN2OSi-2 — CID 166576847
4-(2,2-dimethylpropyl)-5-methyl-2-(9-phenyl-3H-dibenzofuran-3-id-2-yl)pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane (PubChem CID 166576847) has the molecular formula C43H42IrN2OSi-2 and a molecular weight of 823.12 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-5-methyl-2-(9-phenyl-3H-dibenzofuran-3-id-2-yl)pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane.
| Compound Name | 4-(2,2-dimethylpropyl)-5-methyl-2-(9-phenyl-3H-dibenzofuran-3-id-2-yl)pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 166576847 |
| Molecular Formula | C43H42IrN2OSi-2 |
| Molecular Weight | 823.12 g/mol |
| Exact Mass | 823.27 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-5-methyl-2-(9-phenyl-3H-dibenzofuran-3-id-2-yl)pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.Cc1cnc(-c2[c-]cc3oc4cccc(-c5ccccc5)c4c3c2)cc1CC(C)(C)C.[Ir] |
| InChI | InChI=1S/C29H26NO.C14H16NSi.Ir/c1-19-18-30-25(16-22(19)17-29(2,3)4)21-13-14-26-24(15-21)28-23(11-8-12-27(28)31-26)20-9-6-5-7-10-20;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h5-12,14-16,18H,17H2,1-4H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | QXIIDYHGRVPDLP-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.12 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|