C38H40IrN2OSi-2 — CID 164796899
[4-[4-(2,2-dimethylpropyl)-5-methyl-2-pyridinyl]-3H-dibenzofuran-3-id-1-yl]-trimethylsilane;iridium;4-methyl-2-phenylpyridine (PubChem CID 164796899) has the molecular formula C38H40IrN2OSi-2 and a molecular weight of 761.05 g/mol. Its IUPAC name is [4-[4-(2,2-dimethylpropyl)-5-methyl-2-pyridinyl]-3H-dibenzofuran-3-id-1-yl]-trimethylsilane;iridium;4-methyl-2-phenylpyridine.
| Compound Name | [4-[4-(2,2-dimethylpropyl)-5-methyl-2-pyridinyl]-3H-dibenzofuran-3-id-1-yl]-trimethylsilane;iridium;4-methyl-2-phenylpyridine |
|---|---|
| PubChem CID | 164796899 |
| Molecular Formula | C38H40IrN2OSi-2 |
| Molecular Weight | 761.05 g/mol |
| Exact Mass | 761.26 |
| IUPAC Name | [4-[4-(2,2-dimethylpropyl)-5-methyl-2-pyridinyl]-3H-dibenzofuran-3-id-1-yl]-trimethylsilane;iridium;4-methyl-2-phenylpyridine |
| SMILES | Cc1ccnc(-c2[c-]cccc2)c1.Cc1cnc(-c2[c-]cc([Si](C)(C)C)c3c2oc2ccccc23)cc1CC(C)(C)C.[Ir] |
| InChI | InChI=1S/C26H30NOSi.C12H10N.Ir/c1-17-16-27-21(14-18(17)15-26(2,3)4)19-12-13-23(29(5,6)7)24-20-10-8-9-11-22(20)28-25(19)24;1-10-7-8-13-12(9-10)11-5-3-2-4-6-11;/h8-11,13-14,16H,15H2,1-7H3;2-5,7-9H,1H3;/q2*-1; |
| InChIKey | ZBXNZQTWZAHMKQ-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.05 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|