C39H42IrN2OSi-2 — CID 164796811
iridium;4-methyl-2-phenylpyridine;trimethyl-[4-[3-methyl-4-(3-methylpentan-3-yl)-2-pyridinyl]-3H-dibenzofuran-3-id-1-yl]silane (PubChem CID 164796811) has the molecular formula C39H42IrN2OSi-2 and a molecular weight of 775.08 g/mol. Its IUPAC name is iridium;4-methyl-2-phenylpyridine;trimethyl-[4-[3-methyl-4-(3-methylpentan-3-yl)-2-pyridinyl]-3H-dibenzofuran-3-id-1-yl]silane.
| Compound Name | iridium;4-methyl-2-phenylpyridine;trimethyl-[4-[3-methyl-4-(3-methylpentan-3-yl)-2-pyridinyl]-3H-dibenzofuran-3-id-1-yl]silane |
|---|---|
| PubChem CID | 164796811 |
| Molecular Formula | C39H42IrN2OSi-2 |
| Molecular Weight | 775.08 g/mol |
| Exact Mass | 775.27 |
| IUPAC Name | iridium;4-methyl-2-phenylpyridine;trimethyl-[4-[3-methyl-4-(3-methylpentan-3-yl)-2-pyridinyl]-3H-dibenzofuran-3-id-1-yl]silane |
| SMILES | CCC(C)(CC)c1ccnc(-c2[c-]cc([Si](C)(C)C)c3c2oc2ccccc23)c1C.Cc1ccnc(-c2[c-]cccc2)c1.[Ir] |
| InChI | InChI=1S/C27H32NOSi.C12H10N.Ir/c1-8-27(4,9-2)21-16-17-28-25(18(21)3)20-14-15-23(30(5,6)7)24-19-12-10-11-13-22(19)29-26(20)24;1-10-7-8-13-12(9-10)11-5-3-2-4-6-11;/h10-13,15-17H,8-9H2,1-7H3;2-5,7-9H,1H3;/q2*-1; |
| InChIKey | VEHLZKGTEKHWLX-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.08 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|