C38H36IrN2OSi-2 — CID 164796615
[4-[4-(2-bicyclo[2.2.1]heptanyl)-2-pyridinyl]-3H-dibenzofuran-3-id-1-yl]-trimethylsilane;iridium;2-phenylpyridine (PubChem CID 164796615) has the molecular formula C38H36IrN2OSi-2 and a molecular weight of 757.02 g/mol. Its IUPAC name is [4-[4-(2-bicyclo[2.2.1]heptanyl)-2-pyridinyl]-3H-dibenzofuran-3-id-1-yl]-trimethylsilane;iridium;2-phenylpyridine.
| Compound Name | [4-[4-(2-bicyclo[2.2.1]heptanyl)-2-pyridinyl]-3H-dibenzofuran-3-id-1-yl]-trimethylsilane;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 164796615 |
| Molecular Formula | C38H36IrN2OSi-2 |
| Molecular Weight | 757.02 g/mol |
| Exact Mass | 757.22 |
| IUPAC Name | [4-[4-(2-bicyclo[2.2.1]heptanyl)-2-pyridinyl]-3H-dibenzofuran-3-id-1-yl]-trimethylsilane;iridium;2-phenylpyridine |
| SMILES | C[Si](C)(C)c1c[c-]c(-c2cc(C3CC4CCC3C4)ccn2)c2oc3ccccc3c12.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C27H28NOSi.C11H8N.Ir/c1-30(2,3)25-11-10-20(27-26(25)21-6-4-5-7-24(21)29-27)23-16-19(12-13-28-23)22-15-17-8-9-18(22)14-17;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h4-7,11-13,16-18,22H,8-9,14-15H2,1-3H3;1-6,8-9H;/q2*-1; |
| InChIKey | CBGQVYAWAOGLPJ-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.02 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|