C29H34IrNOSi- — CID 164797041
iridium;trimethyl-[4-[4-(2,2,5,5-tetramethylcyclopentyl)-2-pyridinyl]-3H-dibenzofuran-3-id-1-yl]silane (PubChem CID 164797041) has the molecular formula C29H34IrNOSi- and a molecular weight of 632.90 g/mol. Its IUPAC name is iridium;trimethyl-[4-[4-(2,2,5,5-tetramethylcyclopentyl)-2-pyridinyl]-3H-dibenzofuran-3-id-1-yl]silane.
| Compound Name | iridium;trimethyl-[4-[4-(2,2,5,5-tetramethylcyclopentyl)-2-pyridinyl]-3H-dibenzofuran-3-id-1-yl]silane |
|---|---|
| PubChem CID | 164797041 |
| Molecular Formula | C29H34IrNOSi- |
| Molecular Weight | 632.90 g/mol |
| Exact Mass | 633.20 |
| IUPAC Name | iridium;trimethyl-[4-[4-(2,2,5,5-tetramethylcyclopentyl)-2-pyridinyl]-3H-dibenzofuran-3-id-1-yl]silane |
| SMILES | CC1(C)CCC(C)(C)C1c1ccnc(-c2[c-]cc([Si](C)(C)C)c3c2oc2ccccc23)c1.[Ir] |
| InChI | InChI=1S/C29H34NOSi.Ir/c1-28(2)15-16-29(3,4)27(28)19-14-17-30-22(18-19)20-12-13-24(32(5,6)7)25-21-10-8-9-11-23(21)31-26(20)25;/h8-11,13-14,17-18,27H,15-16H2,1-7H3;/q-1; |
| InChIKey | AHWIILUQGRXBQB-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.90 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|