C30H37NOSi — CID 164796927
trimethyl-[4-[4-(3,3,5,5-tetramethylcyclohexyl)-2-pyridinyl]dibenzofuran-1-yl]silane (PubChem CID 164796927) has the molecular formula C30H37NOSi and a molecular weight of 455.72 g/mol. Its IUPAC name is trimethyl-[4-[4-(3,3,5,5-tetramethylcyclohexyl)-2-pyridinyl]dibenzofuran-1-yl]silane.
| Compound Name | trimethyl-[4-[4-(3,3,5,5-tetramethylcyclohexyl)-2-pyridinyl]dibenzofuran-1-yl]silane |
|---|---|
| PubChem CID | 164796927 |
| Molecular Formula | C30H37NOSi |
| Molecular Weight | 455.72 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | trimethyl-[4-[4-(3,3,5,5-tetramethylcyclohexyl)-2-pyridinyl]dibenzofuran-1-yl]silane |
| SMILES | CC1(C)CC(c2ccnc(-c3ccc([Si](C)(C)C)c4c3oc3ccccc34)c2)CC(C)(C)C1 |
| InChI | InChI=1S/C30H37NOSi/c1-29(2)17-21(18-30(3,4)19-29)20-14-15-31-24(16-20)22-12-13-26(33(5,6)7)27-23-10-8-9-11-25(23)32-28(22)27/h8-16,21H,17-19H2,1-7H3 |
| InChIKey | XLOLERZZWHUEKM-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.72 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|