C26H29NSSi — CID 155608457
[4-(4-cyclohexyl-2-pyridinyl)dibenzothiophen-1-yl]-trimethylsilane (PubChem CID 155608457) has the molecular formula C26H29NSSi and a molecular weight of 415.68 g/mol. Its IUPAC name is [4-(4-cyclohexyl-2-pyridinyl)dibenzothiophen-1-yl]-trimethylsilane.
| Compound Name | [4-(4-cyclohexyl-2-pyridinyl)dibenzothiophen-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 155608457 |
| Molecular Formula | C26H29NSSi |
| Molecular Weight | 415.68 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | [4-(4-cyclohexyl-2-pyridinyl)dibenzothiophen-1-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2cc(C3CCCCC3)ccn2)c2sc3ccccc3c12 |
| InChI | InChI=1S/C26H29NSSi/c1-29(2,3)24-14-13-20(26-25(24)21-11-7-8-12-23(21)28-26)22-17-19(15-16-27-22)18-9-5-4-6-10-18/h7-8,11-18H,4-6,9-10H2,1-3H3 |
| InChIKey | BTUWFGQNNDMWNQ-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.68 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|