C34H30IrN2SSi-2 — CID 155608653
4-cyclopropyl-2-phenylpyridine;iridium;trimethyl-(6-pyridin-2-yl-7H-dibenzothiophen-7-id-1-yl)silane (PubChem CID 155608653) has the molecular formula C34H30IrN2SSi-2 and a molecular weight of 719.00 g/mol. Its IUPAC name is 4-cyclopropyl-2-phenylpyridine;iridium;trimethyl-(6-pyridin-2-yl-7H-dibenzothiophen-7-id-1-yl)silane.
| Compound Name | 4-cyclopropyl-2-phenylpyridine;iridium;trimethyl-(6-pyridin-2-yl-7H-dibenzothiophen-7-id-1-yl)silane |
|---|---|
| PubChem CID | 155608653 |
| Molecular Formula | C34H30IrN2SSi-2 |
| Molecular Weight | 719.00 g/mol |
| Exact Mass | 719.15 |
| IUPAC Name | 4-cyclopropyl-2-phenylpyridine;iridium;trimethyl-(6-pyridin-2-yl-7H-dibenzothiophen-7-id-1-yl)silane |
| SMILES | C[Si](C)(C)c1cccc2sc3c(-c4ccccn4)[c-]ccc3c12.[Ir].[c-]1ccccc1-c1cc(C2CC2)ccn1 |
| InChI | InChI=1S/C20H18NSSi.C14H12N.Ir/c1-23(2,3)18-12-7-11-17-19(18)15-9-6-8-14(20(15)22-17)16-10-4-5-13-21-16;1-2-4-12(5-3-1)14-10-13(8-9-15-14)11-6-7-11;/h4-7,9-13H,1-3H3;1-4,8-11H,6-7H2;/q2*-1; |
| InChIKey | WKLJPCDJEVEKGI-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.00 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|