C51H50IrN2SSi-2 — CID 169039315
4-cyclohexyl-2-(9-naphthalen-1-yl-3H-dibenzothiophen-3-id-4-yl)pyridine;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane (PubChem CID 169039315) has the molecular formula C51H50IrN2SSi-2 and a molecular weight of 943.34 g/mol. Its IUPAC name is 4-cyclohexyl-2-(9-naphthalen-1-yl-3H-dibenzothiophen-3-id-4-yl)pyridine;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane.
| Compound Name | 4-cyclohexyl-2-(9-naphthalen-1-yl-3H-dibenzothiophen-3-id-4-yl)pyridine;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
|---|---|
| PubChem CID | 169039315 |
| Molecular Formula | C51H50IrN2SSi-2 |
| Molecular Weight | 943.34 g/mol |
| Exact Mass | 943.31 |
| IUPAC Name | 4-cyclohexyl-2-(9-naphthalen-1-yl-3H-dibenzothiophen-3-id-4-yl)pyridine;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
| SMILES | CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.[Ir].[c-]1ccc2c(sc3cccc(-c4cccc5ccccc45)c32)c1-c1cc(C2CCCCC2)ccn1 |
| InChI | InChI=1S/C33H26NS.C18H24NSi.Ir/c1-2-9-22(10-3-1)24-19-20-34-30(21-24)28-16-7-17-29-32-27(15-8-18-31(32)35-33(28)29)26-14-6-12-23-11-4-5-13-25(23)26;1-14(2)11-16-12-17(15-9-7-6-8-10-15)19-13-18(16)20(3,4)5;/h4-8,11-15,17-22H,1-3,9-10H2;6-9,12-14H,11H2,1-5H3;/q2*-1; |
| InChIKey | TZFHTPKQGBMUAS-UHFFFAOYSA-N |
| XLogP | 14.07 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.34 |
| LogP ≤ 5 | 14.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|