C38H39FIrN2SSi-2 — CID 164712575
2-(3H-dibenzothiophen-3-id-4-yl)-5-fluoro-4-propan-2-ylpyridine;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane (PubChem CID 164712575) has the molecular formula C38H39FIrN2SSi-2 and a molecular weight of 795.11 g/mol. Its IUPAC name is 2-(3H-dibenzothiophen-3-id-4-yl)-5-fluoro-4-propan-2-ylpyridine;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane.
| Compound Name | 2-(3H-dibenzothiophen-3-id-4-yl)-5-fluoro-4-propan-2-ylpyridine;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
|---|---|
| PubChem CID | 164712575 |
| Molecular Formula | C38H39FIrN2SSi-2 |
| Molecular Weight | 795.11 g/mol |
| Exact Mass | 795.22 |
| IUPAC Name | 2-(3H-dibenzothiophen-3-id-4-yl)-5-fluoro-4-propan-2-ylpyridine;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
| SMILES | CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.CC(C)c1cc(-c2[c-]ccc3c2sc2ccccc23)ncc1F.[Ir] |
| InChI | InChI=1S/C20H15FNS.C18H24NSi.Ir/c1-12(2)16-10-18(22-11-17(16)21)15-8-5-7-14-13-6-3-4-9-19(13)23-20(14)15;1-14(2)11-16-12-17(15-9-7-6-8-10-15)19-13-18(16)20(3,4)5;/h3-7,9-12H,1-2H3;6-9,12-14H,11H2,1-5H3;/q2*-1; |
| InChIKey | DFQYPQUSLPHFEP-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.11 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|