C34H31FGeIrN2S-2 — CID 164712996
4-(2-deuteriopropan-2-yl)-2-(3H-dibenzothiophen-3-id-4-yl)-5-fluoropyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane (PubChem CID 164712996) has the molecular formula C34H31FGeIrN2S-2 and a molecular weight of 784.53 g/mol. Its IUPAC name is 4-(2-deuteriopropan-2-yl)-2-(3H-dibenzothiophen-3-id-4-yl)-5-fluoropyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane.
| Compound Name | 4-(2-deuteriopropan-2-yl)-2-(3H-dibenzothiophen-3-id-4-yl)-5-fluoropyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane |
|---|---|
| PubChem CID | 164712996 |
| Molecular Formula | C34H31FGeIrN2S-2 |
| Molecular Weight | 784.53 g/mol |
| Exact Mass | 786.11 |
| IUPAC Name | 4-(2-deuteriopropan-2-yl)-2-(3H-dibenzothiophen-3-id-4-yl)-5-fluoropyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane |
| SMILES | C[Ge](C)(C)c1ccc(-c2[c-]cccc2)nc1.[2H]C(C)(C)c1cc(-c2[c-]ccc3c2sc2ccccc23)ncc1F.[Ir] |
| InChI | InChI=1S/C20H15FNS.C14H16GeN.Ir/c1-12(2)16-10-18(22-11-17(16)21)15-8-5-7-14-13-6-3-4-9-19(13)23-20(14)15;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h3-7,9-12H,1-2H3;4-7,9-11H,1-3H3;/q2*-1;/i12D;; |
| InChIKey | DUBMKRULDIEFLS-USJWNWRASA-N |
| XLogP | 9.27 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.53 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|