C40H34GeIrN2S2-2 — CID 169291829
CID 169291829 (PubChem CID 169291829) has the molecular formula C40H34GeIrN2S2-2 and a molecular weight of 872.69 g/mol.
| Compound Name | CID 169291829 |
|---|---|
| PubChem CID | 169291829 |
| Molecular Formula | C40H34GeIrN2S2-2 |
| Molecular Weight | 872.69 g/mol |
| Exact Mass | 874.11 |
| IUPAC Name | — |
| SMILES | C[Ge](C)(C)c1ccc(-c2[c-]cccc2)nc1.[2H]C(C)(C)c1ccnc(-c2[c-]c3sc4ccccc4c3c3c2sc2ccccc23)c1.[Ir] |
| InChI | InChI=1S/C26H18NS2.C14H16GeN.Ir/c1-15(2)16-11-12-27-20(13-16)19-14-23-24(17-7-3-5-9-21(17)28-23)25-18-8-4-6-10-22(18)29-26(19)25;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h3-13,15H,1-2H3;4-7,9-11H,1-3H3;/q2*-1;/i15D;; |
| InChIKey | UDEQESMOEADFHP-BSRYWEDOSA-N |
| XLogP | 11.50 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.69 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|