C46H38GeIrN2O-2 — CID 171748043
CID 171748043 (PubChem CID 171748043) has the molecular formula C46H38GeIrN2O-2 and a molecular weight of 900.66 g/mol.
| Compound Name | CID 171748043 |
|---|---|
| PubChem CID | 171748043 |
| Molecular Formula | C46H38GeIrN2O-2 |
| Molecular Weight | 900.66 g/mol |
| Exact Mass | 902.19 |
| IUPAC Name | — |
| SMILES | C[Ge](C)(C)c1ccc(-c2[c-]cccc2)nc1.[2H]C(C)(C)c1ccnc(-c2[c-]ccc3c2oc2cc4c5ccccc5c5ccccc5c4cc23)c1.[Ir] |
| InChI | InChI=1S/C32H22NO.C14H16GeN.Ir/c1-19(2)20-14-15-33-30(16-20)26-13-7-12-25-29-17-27-23-10-5-3-8-21(23)22-9-4-6-11-24(22)28(27)18-31(29)34-32(25)26;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h3-12,14-19H,1-2H3;4-7,9-11H,1-3H3;/q2*-1;/i19D;; |
| InChIKey | RGPZRNRGTGDKJE-XYBMBZJXSA-N |
| XLogP | 12.12 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.66 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|