C47H49FIrN2SSi-2 — CID 166574960
4-(2,2-dimethylpropyl)-2-[7-(3-fluorophenyl)-3H-dibenzothiophen-3-id-4-yl]-5-methylpyridine;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane (PubChem CID 166574960) has the molecular formula C47H49FIrN2SSi-2 and a molecular weight of 913.29 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-2-[7-(3-fluorophenyl)-3H-dibenzothiophen-3-id-4-yl]-5-methylpyridine;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane.
| Compound Name | 4-(2,2-dimethylpropyl)-2-[7-(3-fluorophenyl)-3H-dibenzothiophen-3-id-4-yl]-5-methylpyridine;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
|---|---|
| PubChem CID | 166574960 |
| Molecular Formula | C47H49FIrN2SSi-2 |
| Molecular Weight | 913.29 g/mol |
| Exact Mass | 913.30 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-2-[7-(3-fluorophenyl)-3H-dibenzothiophen-3-id-4-yl]-5-methylpyridine;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
| SMILES | CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.Cc1cnc(-c2[c-]ccc3c2sc2cc(-c4cccc(F)c4)ccc23)cc1CC(C)(C)C.[Ir] |
| InChI | InChI=1S/C29H25FNS.C18H24NSi.Ir/c1-18-17-31-26(14-21(18)16-29(2,3)4)25-10-6-9-24-23-12-11-20(15-27(23)32-28(24)25)19-7-5-8-22(30)13-19;1-14(2)11-16-12-17(15-9-7-6-8-10-15)19-13-18(16)20(3,4)5;/h5-9,11-15,17H,16H2,1-4H3;6-9,12-14H,11H2,1-5H3;/q2*-1; |
| InChIKey | WKNIAORTOMIICR-UHFFFAOYSA-N |
| XLogP | 12.91 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.29 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|