C23H23NSSi — CID 155608391
[4-(5-cyclopropyl-2-pyridinyl)dibenzothiophen-1-yl]-trimethylsilane (PubChem CID 155608391) has the molecular formula C23H23NSSi and a molecular weight of 373.60 g/mol. Its IUPAC name is [4-(5-cyclopropyl-2-pyridinyl)dibenzothiophen-1-yl]-trimethylsilane.
| Compound Name | [4-(5-cyclopropyl-2-pyridinyl)dibenzothiophen-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 155608391 |
| Molecular Formula | C23H23NSSi |
| Molecular Weight | 373.60 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | [4-(5-cyclopropyl-2-pyridinyl)dibenzothiophen-1-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc(C3CC3)cn2)c2sc3ccccc3c12 |
| InChI | InChI=1S/C23H23NSSi/c1-26(2,3)21-13-11-17(19-12-10-16(14-24-19)15-8-9-15)23-22(21)18-6-4-5-7-20(18)25-23/h4-7,10-15H,8-9H2,1-3H3 |
| InChIKey | NFAXEMYXIRNYEN-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.60 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|