C25H27NSSi — CID 155608489
[6-(5-cyclopentyl-2-pyridinyl)dibenzothiophen-1-yl]-trimethylsilane (PubChem CID 155608489) has the molecular formula C25H27NSSi and a molecular weight of 401.65 g/mol. Its IUPAC name is [6-(5-cyclopentyl-2-pyridinyl)dibenzothiophen-1-yl]-trimethylsilane.
| Compound Name | [6-(5-cyclopentyl-2-pyridinyl)dibenzothiophen-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 155608489 |
| Molecular Formula | C25H27NSSi |
| Molecular Weight | 401.65 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | [6-(5-cyclopentyl-2-pyridinyl)dibenzothiophen-1-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1cccc2sc3c(-c4ccc(C5CCCC5)cn4)cccc3c12 |
| InChI | InChI=1S/C25H27NSSi/c1-28(2,3)23-13-7-12-22-24(23)20-11-6-10-19(25(20)27-22)21-15-14-18(16-26-21)17-8-4-5-9-17/h6-7,10-17H,4-5,8-9H2,1-3H3 |
| InChIKey | QZYFYSIZZIJZRP-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.65 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|