C21H21NSSi — CID 155608293
trimethyl-[6-[5-(trideuteriomethyl)-2-pyridinyl]dibenzothiophen-4-yl]silane (PubChem CID 155608293) has the molecular formula C21H21NSSi and a molecular weight of 350.58 g/mol. Its IUPAC name is trimethyl-[6-[5-(trideuteriomethyl)-2-pyridinyl]dibenzothiophen-4-yl]silane.
| Compound Name | trimethyl-[6-[5-(trideuteriomethyl)-2-pyridinyl]dibenzothiophen-4-yl]silane |
|---|---|
| PubChem CID | 155608293 |
| Molecular Formula | C21H21NSSi |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | trimethyl-[6-[5-(trideuteriomethyl)-2-pyridinyl]dibenzothiophen-4-yl]silane |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2cccc3c2sc2c([Si](C)(C)C)cccc23)nc1 |
| InChI | InChI=1S/C21H21NSSi/c1-14-11-12-18(22-13-14)17-9-5-7-15-16-8-6-10-19(24(2,3)4)21(16)23-20(15)17/h5-13H,1-4H3/i1D3 |
| InChIKey | MIVNKTNLKGJKLV-FIBGUPNXSA-N |
| XLogP | 5.97 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|