C27H29GeNSSi — CID 164832399
trimethyl-[6-(3-trimethylgermylnaphtho[1,2-b][1]benzothiol-10-yl)-3-pyridinyl]silane (PubChem CID 164832399) has the molecular formula C27H29GeNSSi and a molecular weight of 500.30 g/mol. Its IUPAC name is trimethyl-[6-(3-trimethylgermylnaphtho[1,2-b][1]benzothiol-10-yl)-3-pyridinyl]silane.
| Compound Name | trimethyl-[6-(3-trimethylgermylnaphtho[1,2-b][1]benzothiol-10-yl)-3-pyridinyl]silane |
|---|---|
| PubChem CID | 164832399 |
| Molecular Formula | C27H29GeNSSi |
| Molecular Weight | 500.30 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | trimethyl-[6-(3-trimethylgermylnaphtho[1,2-b][1]benzothiol-10-yl)-3-pyridinyl]silane |
| SMILES | C[Si](C)(C)c1ccc(-c2cccc3c2sc2c4ccc([Ge](C)(C)C)cc4ccc32)nc1 |
| InChI | InChI=1S/C27H29GeNSSi/c1-28(2,3)19-11-14-21-18(16-19)10-13-23-22-8-7-9-24(27(22)30-26(21)23)25-15-12-20(17-29-25)31(4,5)6/h7-17H,1-6H3 |
| InChIKey | GLGXZQHDBOUZKY-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.30 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|