C36H29NSSi — CID 169293440
[4-[7-(6-dibenzothiophen-4-yl-3-pyridinyl)naphthalen-2-yl]phenyl]-trimethylsilane (PubChem CID 169293440) has the molecular formula C36H29NSSi and a molecular weight of 535.79 g/mol. Its IUPAC name is [4-[7-(6-dibenzothiophen-4-yl-3-pyridinyl)naphthalen-2-yl]phenyl]-trimethylsilane.
| Compound Name | [4-[7-(6-dibenzothiophen-4-yl-3-pyridinyl)naphthalen-2-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 169293440 |
| Molecular Formula | C36H29NSSi |
| Molecular Weight | 535.79 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | [4-[7-(6-dibenzothiophen-4-yl-3-pyridinyl)naphthalen-2-yl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc3ccc(-c4ccc(-c5cccc6c5sc5ccccc56)nc4)cc3c2)cc1 |
| InChI | InChI=1S/C36H29NSSi/c1-39(2,3)30-18-15-24(16-19-30)26-13-11-25-12-14-27(22-29(25)21-26)28-17-20-34(37-23-28)33-9-6-8-32-31-7-4-5-10-35(31)38-36(32)33/h4-23H,1-3H3 |
| InChIKey | GDEWMBIMRJSPMW-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.79 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|